C16H18BrClN2 — CID 66158897
1-N-[(2-bromo-5-chlorophenyl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine (PubChem CID 66158897) has the molecular formula C16H18BrClN2 and a molecular weight of 353.69 g/mol. Its IUPAC name is 1-N-[(2-bromo-5-chlorophenyl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(2-bromo-5-chlorophenyl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 66158897 |
| Molecular Formula | C16H18BrClN2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-N-[(2-bromo-5-chlorophenyl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)ccc1NCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C16H18BrClN2/c1-11-8-14(20(2)3)5-7-16(11)19-10-12-9-13(18)4-6-15(12)17/h4-9,19H,10H2,1-3H3 |
| InChIKey | XZLPHVKUZQKMCO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|