C12H12BrClN2O3S — CID 106885182
N-[3-[(3-bromofuran-2-yl)methylamino]-4-chlorophenyl]methanesulfonamide (PubChem CID 106885182) has the molecular formula C12H12BrClN2O3S and a molecular weight of 379.66 g/mol. Its IUPAC name is N-[3-[(3-bromofuran-2-yl)methylamino]-4-chlorophenyl]methanesulfonamide.
| Compound Name | N-[3-[(3-bromofuran-2-yl)methylamino]-4-chlorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 106885182 |
| Molecular Formula | C12H12BrClN2O3S |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | N-[3-[(3-bromofuran-2-yl)methylamino]-4-chlorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cl)c(NCc2occc2Br)c1 |
| InChI | InChI=1S/C12H12BrClN2O3S/c1-20(17,18)16-8-2-3-10(14)11(6-8)15-7-12-9(13)4-5-19-12/h2-6,15-16H,7H2,1H3 |
| InChIKey | XRZDQDFOBHKTMG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |