C12H11ClN2O2 — CID 62329070
6-chloro-N-(1H-pyrrol-2-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 62329070) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 6-chloro-N-(1H-pyrrol-2-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(1H-pyrrol-2-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 62329070 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 6-chloro-N-(1H-pyrrol-2-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NCc1ccc[nH]1)OCO2 |
| InChI | InChI=1S/C12H11ClN2O2/c13-9-4-11-12(17-7-16-11)5-10(9)15-6-8-2-1-3-14-8/h1-5,14-15H,6-7H2 |
| InChIKey | DIIFLKNSWKYBBP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|