C11H10ClN3O2 — CID 43685924
6-chloro-N-(1H-pyrazol-5-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 43685924) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 6-chloro-N-(1H-pyrazol-5-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(1H-pyrazol-5-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685924 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 6-chloro-N-(1H-pyrazol-5-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NCc1ccn[nH]1)OCO2 |
| InChI | InChI=1S/C11H10ClN3O2/c12-8-3-10-11(17-6-16-10)4-9(8)13-5-7-1-2-14-15-7/h1-4,13H,5-6H2,(H,14,15) |
| InChIKey | JCYQZOYYLJLVFU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|