C12H8BrCl2NO2S — CID 102832259
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine (PubChem CID 102832259) has the molecular formula C12H8BrCl2NO2S and a molecular weight of 381.08 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 102832259 |
| Molecular Formula | C12H8BrCl2NO2S |
| Molecular Weight | 381.08 g/mol |
| Exact Mass | 378.88 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NCc1cc(Br)c(Cl)s1)OCO2 |
| InChI | InChI=1S/C12H8BrCl2NO2S/c13-7-1-6(19-12(7)15)4-16-9-3-11-10(2-8(9)14)17-5-18-11/h1-3,16H,4-5H2 |
| InChIKey | SVNIKWZWAXOPEH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|