C25H26 — CID 58282088
2,7-dimethyl-9,9-bis[(2E)-penta-2,4-dienyl]fluorene (PubChem CID 58282088) has the molecular formula C25H26 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2,7-dimethyl-9,9-bis[(2E)-penta-2,4-dienyl]fluorene.
| Compound Name | 2,7-dimethyl-9,9-bis[(2E)-penta-2,4-dienyl]fluorene |
|---|---|
| PubChem CID | 58282088 |
| Molecular Formula | C25H26 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2,7-dimethyl-9,9-bis[(2E)-penta-2,4-dienyl]fluorene |
| SMILES | C=C/C=C/CC1(C/C=C/C=C)c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C25H26/c1-5-7-9-15-25(16-10-8-6-2)23-17-19(3)11-13-21(23)22-14-12-20(4)18-24(22)25/h5-14,17-18H,1-2,15-16H2,3-4H3/b9-7+,10-8+ |
| InChIKey | NMADQMYSPMHIAF-FIFLTTCUSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|