C31H32 — CID 142481380
9-[2-(2,3-dimethylbut-3-en-2-yl)phenyl]-2-methyl-9-[(2Z)-penta-2,4-dienyl]fluorene (PubChem CID 142481380) has the molecular formula C31H32 and a molecular weight of 404.60 g/mol. Its IUPAC name is 9-[2-(2,3-dimethylbut-3-en-2-yl)phenyl]-2-methyl-9-[(2Z)-penta-2,4-dienyl]fluorene.
| Compound Name | 9-[2-(2,3-dimethylbut-3-en-2-yl)phenyl]-2-methyl-9-[(2Z)-penta-2,4-dienyl]fluorene |
|---|---|
| PubChem CID | 142481380 |
| Molecular Formula | C31H32 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 9-[2-(2,3-dimethylbut-3-en-2-yl)phenyl]-2-methyl-9-[(2Z)-penta-2,4-dienyl]fluorene |
| SMILES | C=C/C=C\CC1(c2ccccc2C(C)(C)C(=C)C)c2ccccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C31H32/c1-7-8-13-20-31(28-17-12-11-16-27(28)30(5,6)22(2)3)26-15-10-9-14-24(26)25-19-18-23(4)21-29(25)31/h7-19,21H,1-2,20H2,3-6H3/b13-8- |
| InChIKey | NCRBPYUGFZUQRR-JYRVWZFOSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|