C34H34 — CID 163289482
1',3'-ditert-butyl-7'-methyl-9,9'-spirobi[fluorene] (PubChem CID 163289482) has the molecular formula C34H34 and a molecular weight of 442.65 g/mol. Its IUPAC name is 1',3'-ditert-butyl-7'-methyl-9,9'-spirobi[fluorene].
| Compound Name | 1',3'-ditert-butyl-7'-methyl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 163289482 |
| Molecular Formula | C34H34 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1',3'-ditert-butyl-7'-methyl-9,9'-spirobi[fluorene] |
| SMILES | Cc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1c-2cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C34H34/c1-21-16-17-25-26-19-22(32(2,3)4)20-30(33(5,6)7)31(26)34(29(25)18-21)27-14-10-8-12-23(27)24-13-9-11-15-28(24)34/h8-20H,1-7H3 |
| InChIKey | CYUVETATGLHXIW-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |