C35H34 — CID 163289499
1',3'-ditert-butyl-7'-ethenyl-9,9'-spirobi[fluorene] (PubChem CID 163289499) has the molecular formula C35H34 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1',3'-ditert-butyl-7'-ethenyl-9,9'-spirobi[fluorene].
| Compound Name | 1',3'-ditert-butyl-7'-ethenyl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 163289499 |
| Molecular Formula | C35H34 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1',3'-ditert-butyl-7'-ethenyl-9,9'-spirobi[fluorene] |
| SMILES | C=Cc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1c-2cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C35H34/c1-8-22-17-18-26-27-20-23(33(2,3)4)21-31(34(5,6)7)32(27)35(30(26)19-22)28-15-11-9-13-24(28)25-14-10-12-16-29(25)35/h8-21H,1H2,2-7H3 |
| InChIKey | JWGAENBMQQAHMM-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |