C41H50 — CID 164732300
9,9-bis(3,4-ditert-butylphenyl)fluorene (PubChem CID 164732300) has the molecular formula C41H50 and a molecular weight of 542.85 g/mol. Its IUPAC name is 9,9-bis(3,4-ditert-butylphenyl)fluorene.
| Compound Name | 9,9-bis(3,4-ditert-butylphenyl)fluorene |
|---|---|
| PubChem CID | 164732300 |
| Molecular Formula | C41H50 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | 9,9-bis(3,4-ditert-butylphenyl)fluorene |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)c(C(C)(C)C)c3)c3ccccc3-c3ccccc32)cc1C(C)(C)C |
| InChI | InChI=1S/C41H50/c1-37(2,3)33-23-21-27(25-35(33)39(7,8)9)41(28-22-24-34(38(4,5)6)36(26-28)40(10,11)12)31-19-15-13-17-29(31)30-18-14-16-20-32(30)41/h13-26H,1-12H3 |
| InChIKey | BRVYDTPSWOSNTB-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |