C31H26F6N2O2 — CID 90246896
2-[2-amino-5-[9-[4-amino-3-(2-hydroxypropan-2-yl)phenyl]fluoren-9-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90246896) has the molecular formula C31H26F6N2O2 and a molecular weight of 572.55 g/mol. Its IUPAC name is 2-[2-amino-5-[9-[4-amino-3-(2-hydroxypropan-2-yl)phenyl]fluoren-9-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-amino-5-[9-[4-amino-3-(2-hydroxypropan-2-yl)phenyl]fluoren-9-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90246896 |
| Molecular Formula | C31H26F6N2O2 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-[2-amino-5-[9-[4-amino-3-(2-hydroxypropan-2-yl)phenyl]fluoren-9-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(O)c1cc(C2(c3ccc(N)c(C(O)(C(F)(F)F)C(F)(F)F)c3)c3ccccc3-c3ccccc32)ccc1N |
| InChI | InChI=1S/C31H26F6N2O2/c1-27(2,40)23-15-17(11-13-25(23)38)28(21-9-5-3-7-19(21)20-8-4-6-10-22(20)28)18-12-14-26(39)24(16-18)29(41,30(32,33)34)31(35,36)37/h3-16,40-41H,38-39H2,1-2H3 |
| InChIKey | GEXUUKDCSHUZKW-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|