C20H15F9N2O2 — CID 58516615
2-[3,7-diamino-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58516615) has the molecular formula C20H15F9N2O2 and a molecular weight of 486.33 g/mol. Its IUPAC name is 2-[3,7-diamino-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3,7-diamino-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58516615 |
| Molecular Formula | C20H15F9N2O2 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[3,7-diamino-6-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anthracen-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(O)(c1cc2cc3cc(N)c(C(O)(C(F)(F)F)C(F)(F)F)cc3cc2cc1N)C(F)(F)F |
| InChI | InChI=1S/C20H15F9N2O2/c1-16(32,18(21,22)23)12-4-8-2-11-7-15(31)13(5-9(11)3-10(8)6-14(12)30)17(33,19(24,25)26)20(27,28)29/h2-7,32-33H,30-31H2,1H3 |
| InChIKey | NOBXIXWEMINCCI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|