C13H9F6NO — CID 1336446
2-(2-aminonaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 1336446) has the molecular formula C13H9F6NO and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-(2-aminonaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-aminonaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 1336446 |
| Molecular Formula | C13H9F6NO |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(2-aminonaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc2ccccc2c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F6NO/c14-12(15,16)11(21,13(17,18)19)10-8-4-2-1-3-7(8)5-6-9(10)20/h1-6,21H,20H2 |
| InChIKey | DPKKBYLZGCNYGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|