C76H81N3 — CID 168909014
2-[2',7'-bis(2,4,6-tritert-butylphenyl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 168909014) has the molecular formula C76H81N3 and a molecular weight of 1036.50 g/mol. Its IUPAC name is 2-[2',7'-bis(2,4,6-tritert-butylphenyl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2',7'-bis(2,4,6-tritert-butylphenyl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168909014 |
| Molecular Formula | C76H81N3 |
| Molecular Weight | 1036.50 g/mol |
| Exact Mass | 1035.64 |
| IUPAC Name | 2-[2',7'-bis(2,4,6-tritert-butylphenyl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2ccc3c(c2)C2(c4ccccc4-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc42)c2cc(-c4c(C(C)(C)C)cc(C(C)(C)C)cc4C(C)(C)C)ccc2-3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C76H81N3/c1-70(2,3)51-42-61(72(7,8)9)65(62(43-51)73(10,11)12)48-33-36-55-56-37-34-49(66-63(74(13,14)15)44-52(71(4,5)6)45-64(66)75(16,17)18)40-59(56)76(58(55)39-48)57-32-26-25-31-53(57)54-38-35-50(41-60(54)76)69-78-67(46-27-21-19-22-28-46)77-68(79-69)47-29-23-20-24-30-47/h19-45H,1-18H3 |
| InChIKey | NKLGUKJEPBVXNF-UHFFFAOYSA-N |
| XLogP | 20.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.50 |
| LogP ≤ 5 | 20.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |