C64H55N3O — CID 177242641
2-phenyl-4-(9,9'-spirobi[fluorene]-2-yl)-6-[4-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]-1,3,5-triazine (PubChem CID 177242641) has the molecular formula C64H55N3O and a molecular weight of 882.16 g/mol. Its IUPAC name is 2-phenyl-4-(9,9'-spirobi[fluorene]-2-yl)-6-[4-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(9,9'-spirobi[fluorene]-2-yl)-6-[4-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 177242641 |
| Molecular Formula | C64H55N3O |
| Molecular Weight | 882.16 g/mol |
| Exact Mass | 881.43 |
| IUPAC Name | 2-phenyl-4-(9,9'-spirobi[fluorene]-2-yl)-6-[4-(2,6,8-tritert-butyldibenzofuran-4-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)n3)cc2)c2oc3c(C(C)(C)C)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C64H55N3O/c1-61(2,3)42-34-48(56-49(35-42)50-36-43(62(4,5)6)37-55(57(50)68-56)63(7,8)9)38-27-29-40(30-28-38)59-65-58(39-19-11-10-12-20-39)66-60(67-59)41-31-32-47-46-23-15-18-26-53(46)64(54(47)33-41)51-24-16-13-21-44(51)45-22-14-17-25-52(45)64/h10-37H,1-9H3 |
| InChIKey | REVPQWVNTQNSAW-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.16 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |