C60H49N3O — CID 177242613
2-[4,6-ditert-butyl-8-(9,9-diphenylfluoren-2-yl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 177242613) has the molecular formula C60H49N3O and a molecular weight of 828.07 g/mol. Its IUPAC name is 2-[4,6-ditert-butyl-8-(9,9-diphenylfluoren-2-yl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4,6-ditert-butyl-8-(9,9-diphenylfluoren-2-yl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177242613 |
| Molecular Formula | C60H49N3O |
| Molecular Weight | 828.07 g/mol |
| Exact Mass | 827.39 |
| IUPAC Name | 2-[4,6-ditert-butyl-8-(9,9-diphenylfluoren-2-yl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)cc2c1oc1c(C(C)(C)C)ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c12 |
| InChI | InChI=1S/C60H49N3O/c1-58(2,3)49-34-33-46(57-62-55(38-21-11-7-12-22-38)61-56(63-57)39-23-13-8-14-24-39)52-47-35-41(37-51(59(4,5)6)53(47)64-54(49)52)40-31-32-45-44-29-19-20-30-48(44)60(50(45)36-40,42-25-15-9-16-26-42)43-27-17-10-18-28-43/h7-37H,1-6H3 |
| InChIKey | AVINUFRVLOBSMY-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.07 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |