C40H40 — CID 123493636
2,7-dimethyl-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene (PubChem CID 123493636) has the molecular formula C40H40 and a molecular weight of 520.76 g/mol. Its IUPAC name is 2,7-dimethyl-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene.
| Compound Name | 2,7-dimethyl-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene |
|---|---|
| PubChem CID | 123493636 |
| Molecular Formula | C40H40 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 2,7-dimethyl-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene |
| SMILES | C=C/C=C/CCCCc1cccc(C2(c3cccc(C/C=C/C=C)c3)c3cc(C)ccc3-c3ccc(C)cc32)c1 |
| InChI | InChI=1S/C40H40/c1-5-7-9-10-11-13-17-33-19-15-21-35(29-33)40(34-20-14-18-32(28-34)16-12-8-6-2)38-26-30(3)22-24-36(38)37-25-23-31(4)27-39(37)40/h5-9,12,14-15,18-29H,1-2,10-11,13,16-17H2,3-4H3/b9-7+,12-8+ |
| InChIKey | QLRZBWYMNMIWDT-BRVZEXMBSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|