C47H62 — CID 58371170
9,9-bis[3-(3,7-dimethyloctyl)phenyl]-2,7-dimethylfluorene (PubChem CID 58371170) has the molecular formula C47H62 and a molecular weight of 627.01 g/mol. Its IUPAC name is 9,9-bis[3-(3,7-dimethyloctyl)phenyl]-2,7-dimethylfluorene.
| Compound Name | 9,9-bis[3-(3,7-dimethyloctyl)phenyl]-2,7-dimethylfluorene |
|---|---|
| PubChem CID | 58371170 |
| Molecular Formula | C47H62 |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 626.49 |
| IUPAC Name | 9,9-bis[3-(3,7-dimethyloctyl)phenyl]-2,7-dimethylfluorene |
| SMILES | Cc1ccc2c(c1)C(c1cccc(CCC(C)CCCC(C)C)c1)(c1cccc(CCC(C)CCCC(C)C)c1)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C47H62/c1-33(2)13-9-15-35(5)21-25-39-17-11-19-41(31-39)47(42-20-12-18-40(32-42)26-22-36(6)16-10-14-34(3)4)45-29-37(7)23-27-43(45)44-28-24-38(8)30-46(44)47/h11-12,17-20,23-24,27-36H,9-10,13-16,21-22,25-26H2,1-8H3 |
| InChIKey | UPRCQUKVUODRFQ-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |