C24H29BrO — CID 155647575
2-bromo-1-(9,9-dibutylfluoren-2-yl)propan-1-one (PubChem CID 155647575) has the molecular formula C24H29BrO and a molecular weight of 413.40 g/mol. Its IUPAC name is 2-bromo-1-(9,9-dibutylfluoren-2-yl)propan-1-one.
| Compound Name | 2-bromo-1-(9,9-dibutylfluoren-2-yl)propan-1-one |
|---|---|
| PubChem CID | 155647575 |
| Molecular Formula | C24H29BrO |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-bromo-1-(9,9-dibutylfluoren-2-yl)propan-1-one |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2ccc(C(=O)C(C)Br)cc21 |
| InChI | InChI=1S/C24H29BrO/c1-4-6-14-24(15-7-5-2)21-11-9-8-10-19(21)20-13-12-18(16-22(20)24)23(26)17(3)25/h8-13,16-17H,4-7,14-15H2,1-3H3 |
| InChIKey | XYRJXUIORQKTNU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|