C20H20N2O2 — CID 11023645
7-nitro-9,9-dipropylfluorene-2-carbonitrile (PubChem CID 11023645) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 7-nitro-9,9-dipropylfluorene-2-carbonitrile.
| Compound Name | 7-nitro-9,9-dipropylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 11023645 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 7-nitro-9,9-dipropylfluorene-2-carbonitrile |
| SMILES | CCCC1(CCC)c2cc(C#N)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H20N2O2/c1-3-9-20(10-4-2)18-11-14(13-21)5-7-16(18)17-8-6-15(22(23)24)12-19(17)20/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | ZKWTUFGUKFHWGV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|