C69H66 — CID 58587187
2-[3,5-bis(7-ethynyl-9,9-dipropylfluoren-2-yl)phenyl]-7-ethynyl-9,9-dipropylfluorene (PubChem CID 58587187) has the molecular formula C69H66 and a molecular weight of 895.29 g/mol. Its IUPAC name is 2-[3,5-bis(7-ethynyl-9,9-dipropylfluoren-2-yl)phenyl]-7-ethynyl-9,9-dipropylfluorene.
| Compound Name | 2-[3,5-bis(7-ethynyl-9,9-dipropylfluoren-2-yl)phenyl]-7-ethynyl-9,9-dipropylfluorene |
|---|---|
| PubChem CID | 58587187 |
| Molecular Formula | C69H66 |
| Molecular Weight | 895.29 g/mol |
| Exact Mass | 894.52 |
| IUPAC Name | 2-[3,5-bis(7-ethynyl-9,9-dipropylfluoren-2-yl)phenyl]-7-ethynyl-9,9-dipropylfluorene |
| SMILES | C#Cc1ccc2c(c1)C(CCC)(CCC)c1cc(-c3cc(-c4ccc5c(c4)C(CCC)(CCC)c4cc(C#C)ccc4-5)cc(-c4ccc5c(c4)C(CCC)(CCC)c4cc(C#C)ccc4-5)c3)ccc1-2 |
| InChI | InChI=1S/C69H66/c1-10-31-67(32-11-2)61-37-46(16-7)19-25-55(61)58-28-22-49(43-64(58)67)52-40-53(50-23-29-59-56-26-20-47(17-8)38-62(56)68(33-12-3,34-13-4)65(59)44-50)42-54(41-52)51-24-30-60-57-27-21-48(18-9)39-63(57)69(35-14-5,36-15-6)66(60)45-51/h7-9,19-30,37-45H,10-15,31-36H2,1-6H3 |
| InChIKey | QGSOFHVRAKMWPH-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.29 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|