C23H18 — CID 59798595
2-ethynyl-9,9-dimethyl-7-phenylfluorene (PubChem CID 59798595) has the molecular formula C23H18 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-ethynyl-9,9-dimethyl-7-phenylfluorene.
| Compound Name | 2-ethynyl-9,9-dimethyl-7-phenylfluorene |
|---|---|
| PubChem CID | 59798595 |
| Molecular Formula | C23H18 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-ethynyl-9,9-dimethyl-7-phenylfluorene |
| SMILES | C#Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C23H18/c1-4-16-10-12-19-20-13-11-18(17-8-6-5-7-9-17)15-22(20)23(2,3)21(19)14-16/h1,5-15H,2-3H3 |
| InChIKey | XOXUCBFRVKKJRH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|