C33H34 — CID 86231954
2,7-bis(buta-1,3-diynyl)-9,9-dihexylfluorene (PubChem CID 86231954) has the molecular formula C33H34 and a molecular weight of 430.64 g/mol. Its IUPAC name is 2,7-bis(buta-1,3-diynyl)-9,9-dihexylfluorene.
| Compound Name | 2,7-bis(buta-1,3-diynyl)-9,9-dihexylfluorene |
|---|---|
| PubChem CID | 86231954 |
| Molecular Formula | C33H34 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2,7-bis(buta-1,3-diynyl)-9,9-dihexylfluorene |
| SMILES | C#CC#Cc1ccc2c(c1)C(CCCCCC)(CCCCCC)c1cc(C#CC#C)ccc1-2 |
| InChI | InChI=1S/C33H34/c1-5-9-13-15-23-33(24-16-14-10-6-2)31-25-27(17-11-7-3)19-21-29(31)30-22-20-28(18-12-8-4)26-32(30)33/h3-4,19-22,25-26H,5-6,9-10,13-16,23-24H2,1-2H3 |
| InChIKey | QNGWVJZYKXCYQC-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|