About 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol
3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol (PubChem CID 70876568) has the molecular formula C27H30O2
and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol |
| PubChem CID | 70876568 |
| Molecular Formula | C27H30O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol |
| SMILES | CCCCC1(CCCC)c2cc(C#CCO)ccc2-c2ccc(C#COC)cc21 |
| InChI | InChI=1S/C27H30O2/c1-4-6-15-27(16-7-5-2)25-19-21(9-8-17-28)10-12-23(25)24-13-11-22(14-18-29-3)20-26(24)27/h10-13,19-20,28H,4-7,15-17H2,1-3H3 |
| InChIKey | OZKDOXSFFCMXER-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol?
The IUPAC name of 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol (CID 70876568) is 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol?
The canonical SMILES for 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol is CCCCC1(CCCC)c2cc(C#CCO)ccc2-c2ccc(C#COC)cc21.
What is the InChIKey of 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol?
The InChIKey is OZKDOXSFFCMXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30O2/c1-4-6-15-27(16-7-5-2)25-19-21(9-8-17-28)10-12-23(25)24-13-11-22(14-18-29-3)20-26(24)27/h10-13,19-20,28H,4-7,15-17H2,1-3H3.
What are the key properties of 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol?
3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol has a molecular weight of 386.54 g/mol, XLogP of 5.63, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[9,9-dibutyl-7-(2-methoxyethynyl)fluoren-2-yl]prop-2-yn-1-ol is sourced from PubChem (CID 70876568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).