C73H82Si — CID 23730790
2-[4-[4-[2-[7-[2-(7-ethynyl-9,9-dihexylfluoren-2-yl)ethynyl]-9,9-dihexylfluoren-2-yl]ethynyl]phenyl]phenyl]ethynyl-trimethylsilane (PubChem CID 23730790) has the molecular formula C73H82Si and a molecular weight of 987.54 g/mol. Its IUPAC name is 2-[4-[4-[2-[7-[2-(7-ethynyl-9,9-dihexylfluoren-2-yl)ethynyl]-9,9-dihexylfluoren-2-yl]ethynyl]phenyl]phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-[4-[2-[7-[2-(7-ethynyl-9,9-dihexylfluoren-2-yl)ethynyl]-9,9-dihexylfluoren-2-yl]ethynyl]phenyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 23730790 |
| Molecular Formula | C73H82Si |
| Molecular Weight | 987.54 g/mol |
| Exact Mass | 986.62 |
| IUPAC Name | 2-[4-[4-[2-[7-[2-(7-ethynyl-9,9-dihexylfluoren-2-yl)ethynyl]-9,9-dihexylfluoren-2-yl]ethynyl]phenyl]phenyl]ethynyl-trimethylsilane |
| SMILES | C#Cc1ccc2c(c1)C(CCCCCC)(CCCCCC)c1cc(C#Cc3ccc4c(c3)C(CCCCCC)(CCCCCC)c3cc(C#Cc5ccc(-c6ccc(C#C[Si](C)(C)C)cc6)cc5)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C73H82Si/c1-9-14-18-22-47-72(48-23-19-15-10-2)68-52-56(13-5)34-42-64(68)65-44-36-60(54-69(65)72)28-29-61-37-45-67-66-43-35-59(53-70(66)73(71(67)55-61,49-24-20-16-11-3)50-25-21-17-12-4)27-26-57-30-38-62(39-31-57)63-40-32-58(33-41-63)46-51-74(6,7)8/h5,30-45,52-55H,9-12,14-25,47-50H2,1-4,6-8H3 |
| InChIKey | ORPSOTGBUQIXDI-UHFFFAOYSA-N |
| XLogP | 19.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.54 |
| LogP ≤ 5 | 19.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|