C76H95NO2Si — CID 153392981
N-[4-[9,9-dioctyl-7-(2-trimethylsilylethynyl)fluoren-2-yl]phenyl]-4-(4-hexoxyphenyl)-N-[4-(4-hexoxyphenyl)phenyl]aniline (PubChem CID 153392981) has the molecular formula C76H95NO2Si and a molecular weight of 1082.69 g/mol. Its IUPAC name is N-[4-[9,9-dioctyl-7-(2-trimethylsilylethynyl)fluoren-2-yl]phenyl]-4-(4-hexoxyphenyl)-N-[4-(4-hexoxyphenyl)phenyl]aniline.
| Compound Name | N-[4-[9,9-dioctyl-7-(2-trimethylsilylethynyl)fluoren-2-yl]phenyl]-4-(4-hexoxyphenyl)-N-[4-(4-hexoxyphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 153392981 |
| Molecular Formula | C76H95NO2Si |
| Molecular Weight | 1082.69 g/mol |
| Exact Mass | 1081.71 |
| IUPAC Name | N-[4-[9,9-dioctyl-7-(2-trimethylsilylethynyl)fluoren-2-yl]phenyl]-4-(4-hexoxyphenyl)-N-[4-(4-hexoxyphenyl)phenyl]aniline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C#C[Si](C)(C)C)ccc2-c2ccc(-c3ccc(N(c4ccc(-c5ccc(OCCCCCC)cc5)cc4)c4ccc(-c5ccc(OCCCCCC)cc5)cc4)cc3)cc21 |
| InChI | InChI=1S/C76H95NO2Si/c1-8-12-16-20-22-24-53-76(54-25-23-21-17-13-9-2)74-58-60(52-57-80(5,6)7)28-50-72(74)73-51-39-66(59-75(73)76)65-33-44-69(45-34-65)77(67-40-29-61(30-41-67)63-35-46-70(47-36-63)78-55-26-18-14-10-3)68-42-31-62(32-43-68)64-37-48-71(49-38-64)79-56-27-19-15-11-4/h28-51,58-59H,8-27,53-56H2,1-7H3 |
| InChIKey | KTUPGLCQCFMZLE-UHFFFAOYSA-N |
| XLogP | 23.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.69 |
| LogP ≤ 5 | 23.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|