C27H26N2O3 — CID 11133699
6-methyl-2-(7-nitro-9,9-dipropylfluoren-2-yl)-1,3-benzoxazole (PubChem CID 11133699) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 6-methyl-2-(7-nitro-9,9-dipropylfluoren-2-yl)-1,3-benzoxazole.
| Compound Name | 6-methyl-2-(7-nitro-9,9-dipropylfluoren-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 11133699 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 6-methyl-2-(7-nitro-9,9-dipropylfluoren-2-yl)-1,3-benzoxazole |
| SMILES | CCCC1(CCC)c2cc(-c3nc4ccc(C)cc4o3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C27H26N2O3/c1-4-12-27(13-5-2)22-15-18(26-28-24-11-6-17(3)14-25(24)32-26)7-9-20(22)21-10-8-19(29(30)31)16-23(21)27/h6-11,14-16H,4-5,12-13H2,1-3H3 |
| InChIKey | JYWZUDBZBBDARQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|