C22H18BrN3O4 — CID 4229965
2-bromo-6-[[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)anilino]methyl]-4-nitrophenol (PubChem CID 4229965) has the molecular formula C22H18BrN3O4 and a molecular weight of 468.31 g/mol. Its IUPAC name is 2-bromo-6-[[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)anilino]methyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)anilino]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 4229965 |
| Molecular Formula | C22H18BrN3O4 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 2-bromo-6-[[2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)anilino]methyl]-4-nitrophenol |
| SMILES | Cc1ccc2nc(-c3ccc(C)c(NCc4cc([N+](=O)[O-])cc(Br)c4O)c3)oc2c1 |
| InChI | InChI=1S/C22H18BrN3O4/c1-12-3-6-18-20(7-12)30-22(25-18)14-5-4-13(2)19(9-14)24-11-15-8-16(26(28)29)10-17(23)21(15)27/h3-10,24,27H,11H2,1-2H3 |
| InChIKey | RAPUECIJVJFVNW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|