C14H12Br2N2O3 — CID 107740595
2,6-dibromo-4-[(2-methyl-5-nitroanilino)methyl]phenol (PubChem CID 107740595) has the molecular formula C14H12Br2N2O3 and a molecular weight of 416.07 g/mol. Its IUPAC name is 2,6-dibromo-4-[(2-methyl-5-nitroanilino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(2-methyl-5-nitroanilino)methyl]phenol |
|---|---|
| PubChem CID | 107740595 |
| Molecular Formula | C14H12Br2N2O3 |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 2,6-dibromo-4-[(2-methyl-5-nitroanilino)methyl]phenol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H12Br2N2O3/c1-8-2-3-10(18(20)21)6-13(8)17-7-9-4-11(15)14(19)12(16)5-9/h2-6,17,19H,7H2,1H3 |
| InChIKey | BIPZOUUTKJZKRV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|