C22H23NO4 — CID 145288709
(9,9-dimethyl-7-nitrofluoren-2-yl)-(1-hydroxycyclohexyl)methanone (PubChem CID 145288709) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (9,9-dimethyl-7-nitrofluoren-2-yl)-(1-hydroxycyclohexyl)methanone.
| Compound Name | (9,9-dimethyl-7-nitrofluoren-2-yl)-(1-hydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 145288709 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (9,9-dimethyl-7-nitrofluoren-2-yl)-(1-hydroxycyclohexyl)methanone |
| SMILES | CC1(C)c2cc(C(=O)C3(O)CCCCC3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H23NO4/c1-21(2)18-12-14(20(24)22(25)10-4-3-5-11-22)6-8-16(18)17-9-7-15(23(26)27)13-19(17)21/h6-9,12-13,25H,3-5,10-11H2,1-2H3 |
| InChIKey | OIOZUCPTKHARQM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|