C24H22N2O4 — CID 147465082
[[(9,9-dimethyl-7-nitrofluoren-2-yl)-phenylmethyl]amino] acetate (PubChem CID 147465082) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [[(9,9-dimethyl-7-nitrofluoren-2-yl)-phenylmethyl]amino] acetate.
| Compound Name | [[(9,9-dimethyl-7-nitrofluoren-2-yl)-phenylmethyl]amino] acetate |
|---|---|
| PubChem CID | 147465082 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [[(9,9-dimethyl-7-nitrofluoren-2-yl)-phenylmethyl]amino] acetate |
| SMILES | CC(=O)ONC(c1ccccc1)c1ccc2c(c1)C(C)(C)c1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C24H22N2O4/c1-15(27)30-25-23(16-7-5-4-6-8-16)17-9-11-19-20-12-10-18(26(28)29)14-22(20)24(2,3)21(19)13-17/h4-14,23,25H,1-3H3 |
| InChIKey | FAQXWLBTEPGYGW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|