C28H26N2O5 — CID 144596803
[(E)-[1-[9,9-dimethyl-7-(4-nitrobenzoyl)fluoren-2-yl]-2-methylpropylidene]amino] acetate (PubChem CID 144596803) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is [(E)-[1-[9,9-dimethyl-7-(4-nitrobenzoyl)fluoren-2-yl]-2-methylpropylidene]amino] acetate.
| Compound Name | [(E)-[1-[9,9-dimethyl-7-(4-nitrobenzoyl)fluoren-2-yl]-2-methylpropylidene]amino] acetate |
|---|---|
| PubChem CID | 144596803 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [(E)-[1-[9,9-dimethyl-7-(4-nitrobenzoyl)fluoren-2-yl]-2-methylpropylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/c1ccc2c(c1)C(C)(C)c1cc(C(=O)c3ccc([N+](=O)[O-])cc3)ccc1-2)C(C)C |
| InChI | InChI=1S/C28H26N2O5/c1-16(2)26(29-35-17(3)31)19-8-12-22-23-13-9-20(15-25(23)28(4,5)24(22)14-19)27(32)18-6-10-21(11-7-18)30(33)34/h6-16H,1-5H3/b29-26+ |
| InChIKey | CSFBLSMBMLMACR-PBBVDAKRSA-N |
| XLogP | 6.06 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|