C31H38N2O4 — CID 122485319
[(E)-[(4Z)-4-acetyloxyimino-3-cyclohexyl-4-(9,9-diethylfluoren-2-yl)butan-2-ylidene]amino] acetate (PubChem CID 122485319) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is [(E)-[(4Z)-4-acetyloxyimino-3-cyclohexyl-4-(9,9-diethylfluoren-2-yl)butan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[(4Z)-4-acetyloxyimino-3-cyclohexyl-4-(9,9-diethylfluoren-2-yl)butan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 122485319 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [(E)-[(4Z)-4-acetyloxyimino-3-cyclohexyl-4-(9,9-diethylfluoren-2-yl)butan-2-ylidene]amino] acetate |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(/C(=N\OC(C)=O)C(/C(C)=N/OC(C)=O)C3CCCCC3)cc21 |
| InChI | InChI=1S/C31H38N2O4/c1-6-31(7-2)27-16-12-11-15-25(27)26-18-17-24(19-28(26)31)30(33-37-22(5)35)29(20(3)32-36-21(4)34)23-13-9-8-10-14-23/h11-12,15-19,23,29H,6-10,13-14H2,1-5H3/b32-20+,33-30+ |
| InChIKey | JUTVBLZQDUOSPK-NEFLKXJKSA-N |
| XLogP | 7.18 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|