C31H39NO3 — CID 145280987
[(E)-[1-(9-butan-2-yl-9-propylfluoren-2-yl)-4-cyclopentyl-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 145280987) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is [(E)-[1-(9-butan-2-yl-9-propylfluoren-2-yl)-4-cyclopentyl-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-(9-butan-2-yl-9-propylfluoren-2-yl)-4-cyclopentyl-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 145280987 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | [(E)-[1-(9-butan-2-yl-9-propylfluoren-2-yl)-4-cyclopentyl-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CCCC1(C(C)CC)c2ccccc2-c2ccc(C(=O)/C(CCC3CCCC3)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C31H39NO3/c1-5-19-31(21(3)6-2)27-14-10-9-13-25(27)26-17-16-24(20-28(26)31)30(34)29(32-35-22(4)33)18-15-23-11-7-8-12-23/h9-10,13-14,16-17,20-21,23H,5-8,11-12,15,18-19H2,1-4H3/b32-29+ |
| InChIKey | SMVGCJWNBFBZPV-UUDCSCGESA-N |
| XLogP | 7.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|