C33H38N2O6S — CID 130271917
[(E)-[1-[8-[(2E)-2-butanoyloxyimino-4-cyclopentylbutanoyl]dibenzothiophen-2-yl]-1-oxobutan-2-ylidene]amino] butanoate (PubChem CID 130271917) has the molecular formula C33H38N2O6S and a molecular weight of 590.74 g/mol. Its IUPAC name is [(E)-[1-[8-[(2E)-2-butanoyloxyimino-4-cyclopentylbutanoyl]dibenzothiophen-2-yl]-1-oxobutan-2-ylidene]amino] butanoate.
| Compound Name | [(E)-[1-[8-[(2E)-2-butanoyloxyimino-4-cyclopentylbutanoyl]dibenzothiophen-2-yl]-1-oxobutan-2-ylidene]amino] butanoate |
|---|---|
| PubChem CID | 130271917 |
| Molecular Formula | C33H38N2O6S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [(E)-[1-[8-[(2E)-2-butanoyloxyimino-4-cyclopentylbutanoyl]dibenzothiophen-2-yl]-1-oxobutan-2-ylidene]amino] butanoate |
| SMILES | CCCC(=O)O/N=C(\CC)C(=O)c1ccc2sc3ccc(C(=O)/C(CCC4CCCC4)=N/OC(=O)CCC)cc3c2c1 |
| InChI | InChI=1S/C33H38N2O6S/c1-4-9-30(36)40-34-26(6-3)32(38)22-14-17-28-24(19-22)25-20-23(15-18-29(25)42-28)33(39)27(35-41-31(37)10-5-2)16-13-21-11-7-8-12-21/h14-15,17-21H,4-13,16H2,1-3H3/b34-26+,35-27+ |
| InChIKey | BUJADKDSRHURCB-ZBGIORHCSA-N |
| XLogP | 8.20 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|