C28H30N2O6 — CID 146289937
methyl 2-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-ethylcarbazol-3-yl]-2-oxoacetate (PubChem CID 146289937) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is methyl 2-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-ethylcarbazol-3-yl]-2-oxoacetate.
| Compound Name | methyl 2-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-ethylcarbazol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 146289937 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | methyl 2-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-ethylcarbazol-3-yl]-2-oxoacetate |
| SMILES | CCn1c2ccc(C(=O)C(=O)OC)cc2c2cc(C(=O)/C(CC3CCCCC3)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C28H30N2O6/c1-4-30-24-12-10-19(26(32)23(29-36-17(2)31)14-18-8-6-5-7-9-18)15-21(24)22-16-20(11-13-25(22)30)27(33)28(34)35-3/h10-13,15-16,18H,4-9,14H2,1-3H3/b29-23+ |
| InChIKey | XHYIBADRQHQSJB-BYNJWEBRSA-N |
| XLogP | 5.24 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|