C28H26N2O3 — CID 123139814
[[4-cyclopropyl-1-(9-ethylcarbazol-3-yl)-1-oxobutan-2-ylidene]amino] benzoate (PubChem CID 123139814) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is [[4-cyclopropyl-1-(9-ethylcarbazol-3-yl)-1-oxobutan-2-ylidene]amino] benzoate.
| Compound Name | [[4-cyclopropyl-1-(9-ethylcarbazol-3-yl)-1-oxobutan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 123139814 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [[4-cyclopropyl-1-(9-ethylcarbazol-3-yl)-1-oxobutan-2-ylidene]amino] benzoate |
| SMILES | CCn1c2ccccc2c2cc(C(=O)C(CCC3CC3)=NOC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C28H26N2O3/c1-2-30-25-11-7-6-10-22(25)23-18-21(15-17-26(23)30)27(31)24(16-14-19-12-13-19)29-33-28(32)20-8-4-3-5-9-20/h3-11,15,17-19H,2,12-14,16H2,1H3 |
| InChIKey | MWSQIZCPJKZHEH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|