C40H33N3O2 — CID 156769873
[[(1E,4E)-1,5-bis(9-ethylcarbazol-3-yl)penta-1,4-dien-3-ylidene]amino] benzoate (PubChem CID 156769873) has the molecular formula C40H33N3O2 and a molecular weight of 587.72 g/mol. Its IUPAC name is [[(1E,4E)-1,5-bis(9-ethylcarbazol-3-yl)penta-1,4-dien-3-ylidene]amino] benzoate.
| Compound Name | [[(1E,4E)-1,5-bis(9-ethylcarbazol-3-yl)penta-1,4-dien-3-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 156769873 |
| Molecular Formula | C40H33N3O2 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | [[(1E,4E)-1,5-bis(9-ethylcarbazol-3-yl)penta-1,4-dien-3-ylidene]amino] benzoate |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C(/C=C/c3ccc4c(c3)c3ccccc3n4CC)=NOC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C40H33N3O2/c1-3-42-36-16-10-8-14-32(36)34-26-28(20-24-38(34)42)18-22-31(41-45-40(44)30-12-6-5-7-13-30)23-19-29-21-25-39-35(27-29)33-15-9-11-17-37(33)43(39)4-2/h5-27H,3-4H2,1-2H3/b22-18+,23-19+ |
| InChIKey | VWRJHWKJJFFQEB-DPIBHUQISA-N |
| XLogP | 9.88 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|