C21H19NO3 — CID 126560419
[(Z)-[1-oxo-1-[(9Z)-9-propylidenefluoren-2-yl]propan-2-ylidene]amino] acetate (PubChem CID 126560419) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is [(Z)-[1-oxo-1-[(9Z)-9-propylidenefluoren-2-yl]propan-2-ylidene]amino] acetate.
| Compound Name | [(Z)-[1-oxo-1-[(9Z)-9-propylidenefluoren-2-yl]propan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 126560419 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [(Z)-[1-oxo-1-[(9Z)-9-propylidenefluoren-2-yl]propan-2-ylidene]amino] acetate |
| SMILES | CC/C=C1/c2ccccc2-c2ccc(C(=O)/C(C)=N\OC(C)=O)cc21 |
| InChI | InChI=1S/C21H19NO3/c1-4-7-16-17-8-5-6-9-18(17)19-11-10-15(12-20(16)19)21(24)13(2)22-25-14(3)23/h5-12H,4H2,1-3H3/b16-7-,22-13- |
| InChIKey | XDPNASHFCSBUDH-JNVWOSQMSA-N |
| XLogP | 4.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|