C29H26S2 — CID 51050761
9,9-dimethyl-2,7-bis[(4-methylphenyl)sulfanyl]fluorene (PubChem CID 51050761) has the molecular formula C29H26S2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 9,9-dimethyl-2,7-bis[(4-methylphenyl)sulfanyl]fluorene.
| Compound Name | 9,9-dimethyl-2,7-bis[(4-methylphenyl)sulfanyl]fluorene |
|---|---|
| PubChem CID | 51050761 |
| Molecular Formula | C29H26S2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 9,9-dimethyl-2,7-bis[(4-methylphenyl)sulfanyl]fluorene |
| SMILES | Cc1ccc(Sc2ccc3c(c2)C(C)(C)c2cc(Sc4ccc(C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C29H26S2/c1-19-5-9-21(10-6-19)30-23-13-15-25-26-16-14-24(31-22-11-7-20(2)8-12-22)18-28(26)29(3,4)27(25)17-23/h5-18H,1-4H3 |
| InChIKey | GRGYMJGVMZPVOP-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |