C20H19NO6S — CID 58283541
2-hydroxyethyl 3-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate (PubChem CID 58283541) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-hydroxyethyl 3-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate.
| Compound Name | 2-hydroxyethyl 3-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 58283541 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-hydroxyethyl 3-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate |
| SMILES | CC(=O)O/N=C(\C)C(=O)c1ccc(Sc2cccc(C(=O)OCCO)c2)cc1 |
| InChI | InChI=1S/C20H19NO6S/c1-13(21-27-14(2)23)19(24)15-6-8-17(9-7-15)28-18-5-3-4-16(12-18)20(25)26-11-10-22/h3-9,12,22H,10-11H2,1-2H3/b21-13+ |
| InChIKey | WHECQGJZDKFJGK-FYJGNVAPSA-N |
| XLogP | 3.11 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|