C20H19NO7S — CID 58283624
2-hydroxyethyl 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanyl-3-hydroxybenzoate (PubChem CID 58283624) has the molecular formula C20H19NO7S and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-hydroxyethyl 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanyl-3-hydroxybenzoate.
| Compound Name | 2-hydroxyethyl 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanyl-3-hydroxybenzoate |
|---|---|
| PubChem CID | 58283624 |
| Molecular Formula | C20H19NO7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-hydroxyethyl 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanyl-3-hydroxybenzoate |
| SMILES | CC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(C(=O)OCCO)cc2O)cc1 |
| InChI | InChI=1S/C20H19NO7S/c1-12(21-28-13(2)23)19(25)14-3-6-16(7-4-14)29-18-8-5-15(11-17(18)24)20(26)27-10-9-22/h3-8,11,22,24H,9-10H2,1-2H3/b21-12+ |
| InChIKey | ZOBBJXSMXPJQBB-CIAFOILYSA-N |
| XLogP | 2.81 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|