C19H18FNO5S — CID 76740536
[[1-[3-fluoro-4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 76740536) has the molecular formula C19H18FNO5S and a molecular weight of 391.42 g/mol. Its IUPAC name is [[1-[3-fluoro-4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [[1-[3-fluoro-4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 76740536 |
| Molecular Formula | C19H18FNO5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [[1-[3-fluoro-4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)ON=C(C)C(=O)c1ccc(Sc2ccc(OCCO)cc2)c(F)c1 |
| InChI | InChI=1S/C19H18FNO5S/c1-12(21-26-13(2)23)19(24)14-3-8-18(17(20)11-14)27-16-6-4-15(5-7-16)25-10-9-22/h3-8,11,22H,9-10H2,1-2H3 |
| InChIKey | XAAQXBGKHHQOIZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|