C22H21NO8S — CID 137469341
5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoic acid (PubChem CID 137469341) has the molecular formula C22H21NO8S and a molecular weight of 459.48 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoic acid.
| Compound Name | 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoic acid |
|---|---|
| PubChem CID | 137469341 |
| Molecular Formula | C22H21NO8S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoic acid |
| SMILES | CCC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(C(=O)OCCO)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H21NO8S/c1-3-19(25)31-23-13(2)20(26)17-9-8-16(12-18(17)21(27)28)32-15-6-4-14(5-7-15)22(29)30-11-10-24/h4-9,12,24H,3,10-11H2,1-2H3,(H,27,28)/b23-13+ |
| InChIKey | CSDBKGUPTIQYHP-YDZHTSKRSA-N |
| XLogP | 3.20 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|