C21H20N2O5S — CID 145376679
[(E)-[1-[4-[3-cyano-4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate (PubChem CID 145376679) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [(E)-[1-[4-[3-cyano-4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate.
| Compound Name | [(E)-[1-[4-[3-cyano-4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate |
|---|---|
| PubChem CID | 145376679 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [(E)-[1-[4-[3-cyano-4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] propanoate |
| SMILES | CCC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(OCCO)c(C#N)c2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-3-20(25)28-23-14(2)21(26)15-4-6-17(7-5-15)29-18-8-9-19(27-11-10-24)16(12-18)13-22/h4-9,12,24H,3,10-11H2,1-2H3/b23-14+ |
| InChIKey | RMKHTUNLMOXMDM-OEAKJJBVSA-N |
| XLogP | 3.59 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|