C23H25NO7S — CID 58283589
[2-hydroxy-2-(hydroxymethyl)butyl] 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate (PubChem CID 58283589) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-hydroxy-2-(hydroxymethyl)butyl] 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate.
| Compound Name | [2-hydroxy-2-(hydroxymethyl)butyl] 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 58283589 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [2-hydroxy-2-(hydroxymethyl)butyl] 4-[4-[(2E)-2-acetyloxyiminopropanoyl]phenyl]sulfanylbenzoate |
| SMILES | CCC(O)(CO)COC(=O)c1ccc(Sc2ccc(C(=O)/C(C)=N/OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H25NO7S/c1-4-23(29,13-25)14-30-22(28)18-7-11-20(12-8-18)32-19-9-5-17(6-10-19)21(27)15(2)24-31-16(3)26/h5-12,25,29H,4,13-14H2,1-3H3/b24-15+ |
| InChIKey | WODGLQIIVQBZMZ-BUVRLJJBSA-N |
| XLogP | 3.25 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|