C25H29NO8S — CID 145376707
ethane;methyl 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoate (PubChem CID 145376707) has the molecular formula C25H29NO8S and a molecular weight of 503.57 g/mol. Its IUPAC name is ethane;methyl 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoate.
| Compound Name | ethane;methyl 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoate |
|---|---|
| PubChem CID | 145376707 |
| Molecular Formula | C25H29NO8S |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | ethane;methyl 5-[4-(2-hydroxyethoxycarbonyl)phenyl]sulfanyl-2-[(2E)-2-propanoyloxyiminopropanoyl]benzoate |
| SMILES | CC.CCC(=O)O/N=C(\C)C(=O)c1ccc(Sc2ccc(C(=O)OCCO)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C23H23NO8S.C2H6/c1-4-20(26)32-24-14(2)21(27)18-10-9-17(13-19(18)23(29)30-3)33-16-7-5-15(6-8-16)22(28)31-12-11-25;1-2/h5-10,13,25H,4,11-12H2,1-3H3;1-2H3/b24-14+; |
| InChIKey | DZOARHMOMNOERN-SXMBIPSUSA-N |
| XLogP | 4.31 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|