C26H29NO3S2 — CID 143968424
[(E)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] (Z)-2-ethenylsulfanylbut-2-enoate (PubChem CID 143968424) has the molecular formula C26H29NO3S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] (Z)-2-ethenylsulfanylbut-2-enoate.
| Compound Name | [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] (Z)-2-ethenylsulfanylbut-2-enoate |
|---|---|
| PubChem CID | 143968424 |
| Molecular Formula | C26H29NO3S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [(E)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] (Z)-2-ethenylsulfanylbut-2-enoate |
| SMILES | C=CS/C(=C\C)C(=O)O/N=C(\CCCCCC)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO3S2/c1-4-7-8-12-15-23(27-30-26(29)24(5-2)31-6-3)25(28)20-16-18-22(19-17-20)32-21-13-10-9-11-14-21/h5-6,9-11,13-14,16-19H,3-4,7-8,12,15H2,1-2H3/b24-5-,27-23+ |
| InChIKey | SBFZZAAHAWQDND-WRAOUITRSA-N |
| XLogP | 7.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|