C21H25NO4S2 — CID 123741908
[(Z)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] methanesulfonate (PubChem CID 123741908) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(Z)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 123741908 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [(Z)-[1-oxo-1-(4-phenylsulfanylphenyl)octan-2-ylidene]amino] methanesulfonate |
| SMILES | CCCCCC/C(=N/OS(C)(=O)=O)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO4S2/c1-3-4-5-9-12-20(22-26-28(2,24)25)21(23)17-13-15-19(16-14-17)27-18-10-7-6-8-11-18/h6-8,10-11,13-16H,3-5,9,12H2,1-2H3/b22-20- |
| InChIKey | IAPHAGODPXOREX-XDOYNYLZSA-N |
| XLogP | 5.32 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|