C28H31NO3S — CID 155002677
[(Z)-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate (PubChem CID 155002677) has the molecular formula C28H31NO3S and a molecular weight of 461.63 g/mol. Its IUPAC name is [(Z)-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate.
| Compound Name | [(Z)-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 155002677 |
| Molecular Formula | C28H31NO3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [(Z)-[1-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylphenyl]-1-oxooctan-2-ylidene]amino] benzoate |
| SMILES | C=C/C=C(\C=C/C)Sc1ccc(C(=O)/C(CCCCCC)=N\OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO3S/c1-4-7-8-12-17-26(29-32-28(31)23-15-10-9-11-16-23)27(30)22-18-20-25(21-19-22)33-24(13-5-2)14-6-3/h5-6,9-11,13-16,18-21H,2,4,7-8,12,17H2,1,3H3/b14-6-,24-13+,29-26- |
| InChIKey | YPTDYLUMOZIPHX-HILKQHFWSA-N |
| XLogP | 7.79 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|